C17H20N5O10S- — CID 171666212
(2S)-2-azaniumyl-5-[[(2R)-1-(carboxylatomethylamino)-3-(2-methyl-3,5-dinitrophenyl)sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoate (PubChem CID 171666212) has the molecular formula C17H20N5O10S- and a molecular weight of 486.44 g/mol. Its IUPAC name is (2S)-2-azaniumyl-5-[[(2R)-1-(carboxylatomethylamino)-3-(2-methyl-3,5-dinitrophenyl)sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoate.
| Compound Name | (2S)-2-azaniumyl-5-[[(2R)-1-(carboxylatomethylamino)-3-(2-methyl-3,5-dinitrophenyl)sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 171666212 |
| Molecular Formula | C17H20N5O10S- |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | (2S)-2-azaniumyl-5-[[(2R)-1-(carboxylatomethylamino)-3-(2-methyl-3,5-dinitrophenyl)sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoate |
| SMILES | Cc1c(SC[C@H](NC(=O)CC[C@H]([NH3+])C(=O)[O-])C(=O)NCC(=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N5O10S/c1-8-12(22(31)32)4-9(21(29)30)5-13(8)33-7-11(16(26)19-6-15(24)25)20-14(23)3-2-10(18)17(27)28/h4-5,10-11H,2-3,6-7,18H2,1H3,(H,19,26)(H,20,23)(H,24,25)(H,27,28)/p-1/t10-,11-/m0/s1 |
| InChIKey | GZCVDUUXUHYGPT-QWRGUYRKSA-M |
| XLogP | -3.60 |
| TPSA | 252.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|