C22H31N5O10S — CID 91317984
propan-2-yl 2-amino-5-[[3-(2,4-dinitrophenyl)sulfanyl-1-oxo-1-[(2-oxo-2-propan-2-yloxyethyl)amino]propan-2-yl]amino]-5-oxopentanoate (PubChem CID 91317984) has the molecular formula C22H31N5O10S and a molecular weight of 557.58 g/mol. Its IUPAC name is propan-2-yl 2-amino-5-[[3-(2,4-dinitrophenyl)sulfanyl-1-oxo-1-[(2-oxo-2-propan-2-yloxyethyl)amino]propan-2-yl]amino]-5-oxopentanoate.
| Compound Name | propan-2-yl 2-amino-5-[[3-(2,4-dinitrophenyl)sulfanyl-1-oxo-1-[(2-oxo-2-propan-2-yloxyethyl)amino]propan-2-yl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 91317984 |
| Molecular Formula | C22H31N5O10S |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | propan-2-yl 2-amino-5-[[3-(2,4-dinitrophenyl)sulfanyl-1-oxo-1-[(2-oxo-2-propan-2-yloxyethyl)amino]propan-2-yl]amino]-5-oxopentanoate |
| SMILES | CC(C)OC(=O)CNC(=O)C(CSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])NC(=O)CCC(N)C(=O)OC(C)C |
| InChI | InChI=1S/C22H31N5O10S/c1-12(2)36-20(29)10-24-21(30)16(25-19(28)8-6-15(23)22(31)37-13(3)4)11-38-18-7-5-14(26(32)33)9-17(18)27(34)35/h5,7,9,12-13,15-16H,6,8,10-11,23H2,1-4H3,(H,24,30)(H,25,28) |
| InChIKey | GMVQJDBKYGAEFL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 223.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|