C19H25N5O9S2 — CID 101139855
(2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-[[3-(dimethylcarbamoyl)-4-nitrophenyl]disulfanyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 101139855) has the molecular formula C19H25N5O9S2 and a molecular weight of 531.57 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-[[3-(dimethylcarbamoyl)-4-nitrophenyl]disulfanyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-[[3-(dimethylcarbamoyl)-4-nitrophenyl]disulfanyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 101139855 |
| Molecular Formula | C19H25N5O9S2 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-[[3-(dimethylcarbamoyl)-4-nitrophenyl]disulfanyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CN(C)C(=O)c1cc(SSC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H25N5O9S2/c1-23(2)18(29)11-7-10(3-5-14(11)24(32)33)35-34-9-13(17(28)21-8-16(26)27)22-15(25)6-4-12(20)19(30)31/h3,5,7,12-13H,4,6,8-9,20H2,1-2H3,(H,21,28)(H,22,25)(H,26,27)(H,30,31)/t12-,13-/m0/s1 |
| InChIKey | IAAVBVZNRRATBL-STQMWFEESA-N |
| XLogP | -0.09 |
| TPSA | 222.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|