C30H37N7O14S — CID 134150161
butyl (2S)-5-[[(2R)-1-[(2-butoxy-2-oxoethyl)amino]-3-(2,4-dinitrophenyl)sulfanyl-1-oxopropan-2-yl]amino]-2-(2,4-dinitroanilino)-5-oxopentanoate (PubChem CID 134150161) has the molecular formula C30H37N7O14S and a molecular weight of 751.73 g/mol. Its IUPAC name is butyl (2S)-5-[[(2R)-1-[(2-butoxy-2-oxoethyl)amino]-3-(2,4-dinitrophenyl)sulfanyl-1-oxopropan-2-yl]amino]-2-(2,4-dinitroanilino)-5-oxopentanoate.
| Compound Name | butyl (2S)-5-[[(2R)-1-[(2-butoxy-2-oxoethyl)amino]-3-(2,4-dinitrophenyl)sulfanyl-1-oxopropan-2-yl]amino]-2-(2,4-dinitroanilino)-5-oxopentanoate |
|---|---|
| PubChem CID | 134150161 |
| Molecular Formula | C30H37N7O14S |
| Molecular Weight | 751.73 g/mol |
| Exact Mass | 751.21 |
| IUPAC Name | butyl (2S)-5-[[(2R)-1-[(2-butoxy-2-oxoethyl)amino]-3-(2,4-dinitrophenyl)sulfanyl-1-oxopropan-2-yl]amino]-2-(2,4-dinitroanilino)-5-oxopentanoate |
| SMILES | CCCCOC(=O)CNC(=O)[C@H](CSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])NC(=O)CC[C@H](Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)OCCCC |
| InChI | InChI=1S/C30H37N7O14S/c1-3-5-13-50-28(39)17-31-29(40)23(18-52-26-11-8-20(35(44)45)16-25(26)37(48)49)33-27(38)12-10-22(30(41)51-14-6-4-2)32-21-9-7-19(34(42)43)15-24(21)36(46)47/h7-9,11,15-16,22-23,32H,3-6,10,12-14,17-18H2,1-2H3,(H,31,40)(H,33,38)/t22-,23-/m0/s1 |
| InChIKey | HCZKQGDTOWAZPB-GOTSBHOMSA-N |
| XLogP | 3.96 |
| TPSA | 295.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.73 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|