C28H33N5O12S — CID 11082889
(2S)-5-[[(2R)-1-[(2-butoxy-2-oxoethyl)amino]-3-(2,4-dinitrophenyl)sulfanyl-1-oxopropan-2-yl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 11082889) has the molecular formula C28H33N5O12S and a molecular weight of 663.66 g/mol. Its IUPAC name is (2S)-5-[[(2R)-1-[(2-butoxy-2-oxoethyl)amino]-3-(2,4-dinitrophenyl)sulfanyl-1-oxopropan-2-yl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | (2S)-5-[[(2R)-1-[(2-butoxy-2-oxoethyl)amino]-3-(2,4-dinitrophenyl)sulfanyl-1-oxopropan-2-yl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 11082889 |
| Molecular Formula | C28H33N5O12S |
| Molecular Weight | 663.66 g/mol |
| Exact Mass | 663.18 |
| IUPAC Name | (2S)-5-[[(2R)-1-[(2-butoxy-2-oxoethyl)amino]-3-(2,4-dinitrophenyl)sulfanyl-1-oxopropan-2-yl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | CCCCOC(=O)CNC(=O)[C@H](CSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])NC(=O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C28H33N5O12S/c1-2-3-13-44-25(35)15-29-26(36)21(17-46-23-11-9-19(32(40)41)14-22(23)33(42)43)30-24(34)12-10-20(27(37)38)31-28(39)45-16-18-7-5-4-6-8-18/h4-9,11,14,20-21H,2-3,10,12-13,15-17H2,1H3,(H,29,36)(H,30,34)(H,31,39)(H,37,38)/t20-,21-/m0/s1 |
| InChIKey | MDVPAOKIEFJFSU-SFTDATJTSA-N |
| XLogP | 2.70 |
| TPSA | 246.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.66 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|