C30H45N5O11S — CID 134136199
butyl (2S)-5-[[(2R)-1-[(2-butoxy-2-oxoethyl)amino]-3-(2,4-dinitrophenyl)sulfanyl-1-oxopropan-2-yl]amino]-2-(4-methylpentanoylamino)-5-oxopentanoate (PubChem CID 134136199) has the molecular formula C30H45N5O11S and a molecular weight of 683.78 g/mol. Its IUPAC name is butyl (2S)-5-[[(2R)-1-[(2-butoxy-2-oxoethyl)amino]-3-(2,4-dinitrophenyl)sulfanyl-1-oxopropan-2-yl]amino]-2-(4-methylpentanoylamino)-5-oxopentanoate.
| Compound Name | butyl (2S)-5-[[(2R)-1-[(2-butoxy-2-oxoethyl)amino]-3-(2,4-dinitrophenyl)sulfanyl-1-oxopropan-2-yl]amino]-2-(4-methylpentanoylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 134136199 |
| Molecular Formula | C30H45N5O11S |
| Molecular Weight | 683.78 g/mol |
| Exact Mass | 683.28 |
| IUPAC Name | butyl (2S)-5-[[(2R)-1-[(2-butoxy-2-oxoethyl)amino]-3-(2,4-dinitrophenyl)sulfanyl-1-oxopropan-2-yl]amino]-2-(4-methylpentanoylamino)-5-oxopentanoate |
| SMILES | CCCCOC(=O)CNC(=O)[C@H](CSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])NC(=O)CC[C@H](NC(=O)CCC(C)C)C(=O)OCCCC |
| InChI | InChI=1S/C30H45N5O11S/c1-5-7-15-45-28(38)18-31-29(39)23(19-47-25-12-10-21(34(41)42)17-24(25)35(43)44)33-27(37)14-11-22(30(40)46-16-8-6-2)32-26(36)13-9-20(3)4/h10,12,17,20,22-23H,5-9,11,13-16,18-19H2,1-4H3,(H,31,39)(H,32,36)(H,33,37)/t22-,23-/m0/s1 |
| InChIKey | JXDKAOHGKUGPOA-GOTSBHOMSA-N |
| XLogP | 3.58 |
| TPSA | 226.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.78 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|