C25H43N3O10S — CID 56996406
2-amino-5-[[3-(1,4-dibutoxy-1,4-dioxobutan-2-yl)sulfanyl-1-oxo-1-[(2-oxo-2-propan-2-yloxyethyl)amino]propan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 56996406) has the molecular formula C25H43N3O10S and a molecular weight of 577.70 g/mol. Its IUPAC name is 2-amino-5-[[3-(1,4-dibutoxy-1,4-dioxobutan-2-yl)sulfanyl-1-oxo-1-[(2-oxo-2-propan-2-yloxyethyl)amino]propan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[3-(1,4-dibutoxy-1,4-dioxobutan-2-yl)sulfanyl-1-oxo-1-[(2-oxo-2-propan-2-yloxyethyl)amino]propan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 56996406 |
| Molecular Formula | C25H43N3O10S |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | 2-amino-5-[[3-(1,4-dibutoxy-1,4-dioxobutan-2-yl)sulfanyl-1-oxo-1-[(2-oxo-2-propan-2-yloxyethyl)amino]propan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CCCCOC(=O)CC(SCC(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)OC(C)C)C(=O)OCCCC |
| InChI | InChI=1S/C25H43N3O10S/c1-5-7-11-36-21(30)13-19(25(35)37-12-8-6-2)39-15-18(23(32)27-14-22(31)38-16(3)4)28-20(29)10-9-17(26)24(33)34/h16-19H,5-15,26H2,1-4H3,(H,27,32)(H,28,29)(H,33,34) |
| InChIKey | XRKPKSJUTQOVQQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 200.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|