C14H21CaN3O10S — CID 86746843
S-(alpha,beta-dicarboxyethyl)glutathione calcium (PubChem CID 86746843) has the molecular formula C14H21CaN3O10S and a molecular weight of 463.48 g/mol.
| Compound Name | S-(alpha,beta-dicarboxyethyl)glutathione calcium |
|---|---|
| PubChem CID | 86746843 |
| Molecular Formula | C14H21CaN3O10S |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | — |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSC(CC(=O)O)C(=O)O)C(=O)NCC(=O)O)C(=O)O.[Ca] |
| InChI | InChI=1S/C14H21N3O10S.Ca/c15-6(13(24)25)1-2-9(18)17-7(12(23)16-4-11(21)22)5-28-8(14(26)27)3-10(19)20;/h6-8H,1-5,15H2,(H,16,23)(H,17,18)(H,19,20)(H,21,22)(H,24,25)(H,26,27);/t6-,7-,8?;/m0./s1 |
| InChIKey | IPUJEUSSBDUDOI-NKGRROCASA-N |
| XLogP | -2.86 |
| TPSA | 233.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |