C10H6N6O8 — CID 5198221
5-(2,4,6-trinitroanilino)-1H-pyrimidine-2,4-dione (PubChem CID 5198221) has the molecular formula C10H6N6O8 and a molecular weight of 338.19 g/mol. Its IUPAC name is 5-(2,4,6-trinitroanilino)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(2,4,6-trinitroanilino)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 5198221 |
| Molecular Formula | C10H6N6O8 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 5-(2,4,6-trinitroanilino)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C10H6N6O8/c17-9-5(3-11-10(18)13-9)12-8-6(15(21)22)1-4(14(19)20)2-7(8)16(23)24/h1-3,12H,(H2,11,13,17,18) |
| InChIKey | SOWMPOVGUVAIIQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 207.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|