C10H9N7O5 — CID 135455399
2,4-diamino-5-(2,4-dinitroanilino)-1H-pyrimidin-6-one (PubChem CID 135455399) has the molecular formula C10H9N7O5 and a molecular weight of 307.23 g/mol. Its IUPAC name is 2,4-diamino-5-(2,4-dinitroanilino)-1H-pyrimidin-6-one.
| Compound Name | 2,4-diamino-5-(2,4-dinitroanilino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135455399 |
| Molecular Formula | C10H9N7O5 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 2,4-diamino-5-(2,4-dinitroanilino)-1H-pyrimidin-6-one |
| SMILES | Nc1nc(N)c(Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C10H9N7O5/c11-8-7(9(18)15-10(12)14-8)13-5-2-1-4(16(19)20)3-6(5)17(21)22/h1-3,13H,(H5,11,12,14,15,18) |
| InChIKey | ZOKLFFDMLBVCNA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 196.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|