C16H14NO7- — CID 163117451
4-(dihydroxyamino)-2-(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)phenolate (PubChem CID 163117451) has the molecular formula C16H14NO7- and a molecular weight of 332.29 g/mol. Its IUPAC name is 4-(dihydroxyamino)-2-(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)phenolate.
| Compound Name | 4-(dihydroxyamino)-2-(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)phenolate |
|---|---|
| PubChem CID | 163117451 |
| Molecular Formula | C16H14NO7- |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 4-(dihydroxyamino)-2-(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)phenolate |
| SMILES | COc1ccc2c(c1OC)C(=O)OC2c1cc(N(O)O)ccc1[O-] |
| InChI | InChI=1S/C16H15NO7/c1-22-12-6-4-9-13(15(12)23-2)16(19)24-14(9)10-7-8(17(20)21)3-5-11(10)18/h3-7,14,18,20-21H,1-2H3/p-1 |
| InChIKey | AXPGBAZTFDUSIA-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|