C22H26O5 — CID 3324812
3-[2-(1-adamantyl)-2-oxoethyl]-6,7-dimethoxy-3H-2-benzofuran-1-one (PubChem CID 3324812) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-[2-(1-adamantyl)-2-oxoethyl]-6,7-dimethoxy-3H-2-benzofuran-1-one.
| Compound Name | 3-[2-(1-adamantyl)-2-oxoethyl]-6,7-dimethoxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 3324812 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 3-[2-(1-adamantyl)-2-oxoethyl]-6,7-dimethoxy-3H-2-benzofuran-1-one |
| SMILES | COc1ccc2c(c1OC)C(=O)OC2CC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H26O5/c1-25-16-4-3-15-17(27-21(24)19(15)20(16)26-2)8-18(23)22-9-12-5-13(10-22)7-14(6-12)11-22/h3-4,12-14,17H,5-11H2,1-2H3 |
| InChIKey | PLTSXWJSGHXZAU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |