C18H14I2O6 — CID 92907509
(3S)-3-[2-(4-hydroxy-3,5-diiodophenyl)-2-oxoethyl]-6,7-dimethoxy-3H-2-benzofuran-1-one (PubChem CID 92907509) has the molecular formula C18H14I2O6 and a molecular weight of 580.11 g/mol. Its IUPAC name is (3S)-3-[2-(4-hydroxy-3,5-diiodophenyl)-2-oxoethyl]-6,7-dimethoxy-3H-2-benzofuran-1-one.
| Compound Name | (3S)-3-[2-(4-hydroxy-3,5-diiodophenyl)-2-oxoethyl]-6,7-dimethoxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 92907509 |
| Molecular Formula | C18H14I2O6 |
| Molecular Weight | 580.11 g/mol |
| Exact Mass | 579.89 |
| IUPAC Name | (3S)-3-[2-(4-hydroxy-3,5-diiodophenyl)-2-oxoethyl]-6,7-dimethoxy-3H-2-benzofuran-1-one |
| SMILES | COc1ccc2c(c1OC)C(=O)O[C@H]2CC(=O)c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C18H14I2O6/c1-24-13-4-3-9-14(26-18(23)15(9)17(13)25-2)7-12(21)8-5-10(19)16(22)11(20)6-8/h3-6,14,22H,7H2,1-2H3/t14-/m0/s1 |
| InChIKey | KYXKGYQEEPAHRJ-AWEZNQCLSA-N |
| XLogP | 4.10 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.11 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|