C16H14INO4 — CID 7657817
(3S)-3-(3-iodoanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one (PubChem CID 7657817) has the molecular formula C16H14INO4 and a molecular weight of 411.20 g/mol. Its IUPAC name is (3S)-3-(3-iodoanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one.
| Compound Name | (3S)-3-(3-iodoanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 7657817 |
| Molecular Formula | C16H14INO4 |
| Molecular Weight | 411.20 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | (3S)-3-(3-iodoanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one |
| SMILES | COc1ccc2c(c1OC)C(=O)O[C@@H]2Nc1cccc(I)c1 |
| InChI | InChI=1S/C16H14INO4/c1-20-12-7-6-11-13(14(12)21-2)16(19)22-15(11)18-10-5-3-4-9(17)8-10/h3-8,15,18H,1-2H3/t15-/m0/s1 |
| InChIKey | ABFFJORUNHEVPP-HNNXBMFYSA-N |
| XLogP | 3.59 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|