About 3-(butylamino)-6,7-dimethoxy-3H-2-benzofuran-1-one
3-(butylamino)-6,7-dimethoxy-3H-2-benzofuran-1-one (PubChem CID 4763424) has the molecular formula C14H19NO4
and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-(butylamino)-6,7-dimethoxy-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 3-(butylamino)-6,7-dimethoxy-3H-2-benzofuran-1-one |
| PubChem CID | 4763424 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 3-(butylamino)-6,7-dimethoxy-3H-2-benzofuran-1-one |
| SMILES | CCCCNC1OC(=O)c2c1ccc(OC)c2OC |
| InChI | InChI=1S/C14H19NO4/c1-4-5-8-15-13-9-6-7-10(17-2)12(18-3)11(9)14(16)19-13/h6-7,13,15H,4-5,8H2,1-3H3 |
| InChIKey | VXIVUIBSIWKEGY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(butylamino)-6,7-dimethoxy-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(butylamino)-6,7-dimethoxy-3H-2-benzofuran-1-one?
The IUPAC name of 3-(butylamino)-6,7-dimethoxy-3H-2-benzofuran-1-one (CID 4763424) is 3-(butylamino)-6,7-dimethoxy-3H-2-benzofuran-1-one.
What is the SMILES notation for 3-(butylamino)-6,7-dimethoxy-3H-2-benzofuran-1-one?
The canonical SMILES for 3-(butylamino)-6,7-dimethoxy-3H-2-benzofuran-1-one is CCCCNC1OC(=O)c2c1ccc(OC)c2OC.
What is the InChIKey of 3-(butylamino)-6,7-dimethoxy-3H-2-benzofuran-1-one?
The InChIKey is VXIVUIBSIWKEGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4/c1-4-5-8-15-13-9-6-7-10(17-2)12(18-3)11(9)14(16)19-13/h6-7,13,15H,4-5,8H2,1-3H3.
What are the key properties of 3-(butylamino)-6,7-dimethoxy-3H-2-benzofuran-1-one?
3-(butylamino)-6,7-dimethoxy-3H-2-benzofuran-1-one has a molecular weight of 265.31 g/mol, XLogP of 2.26, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(butylamino)-6,7-dimethoxy-3H-2-benzofuran-1-one is sourced from PubChem (CID 4763424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).