C26H25N5O3S — CID 46304933
ethyl 1-phenyl-5-[2-(6-phenylpyrimidin-4-yl)sulfanylbutanoylamino]pyrazole-4-carboxylate (PubChem CID 46304933) has the molecular formula C26H25N5O3S and a molecular weight of 487.59 g/mol. Its IUPAC name is ethyl 1-phenyl-5-[2-(6-phenylpyrimidin-4-yl)sulfanylbutanoylamino]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-phenyl-5-[2-(6-phenylpyrimidin-4-yl)sulfanylbutanoylamino]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 46304933 |
| Molecular Formula | C26H25N5O3S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | ethyl 1-phenyl-5-[2-(6-phenylpyrimidin-4-yl)sulfanylbutanoylamino]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccccc2)c1NC(=O)C(CC)Sc1cc(-c2ccccc2)ncn1 |
| InChI | InChI=1S/C26H25N5O3S/c1-3-22(35-23-15-21(27-17-28-23)18-11-7-5-8-12-18)25(32)30-24-20(26(33)34-4-2)16-29-31(24)19-13-9-6-10-14-19/h5-17,22H,3-4H2,1-2H3,(H,30,32) |
| InChIKey | BAUSQMKHMWBTIX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |