C32H28N2O4S — CID 21168759
ethyl 4-[[2-phenyl-2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate (PubChem CID 21168759) has the molecular formula C32H28N2O4S and a molecular weight of 536.65 g/mol. Its IUPAC name is ethyl 4-[[2-phenyl-2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-phenyl-2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 21168759 |
| Molecular Formula | C32H28N2O4S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | ethyl 4-[[2-phenyl-2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(Sc2ccc(NC(=O)/C=C/c3ccccc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H28N2O4S/c1-2-38-32(37)25-14-16-27(17-15-25)34-31(36)30(24-11-7-4-8-12-24)39-28-20-18-26(19-21-28)33-29(35)22-13-23-9-5-3-6-10-23/h3-22,30H,2H2,1H3,(H,33,35)(H,34,36)/b22-13+ |
| InChIKey | XZZPJAGNEGZSTA-LPYMAVHISA-N |
| XLogP | 6.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|