C20H18BrNO3 — CID 3512602
ethyl 4-[(4-bromo-5-phenylpenta-2,4-dienoyl)amino]benzoate (PubChem CID 3512602) has the molecular formula C20H18BrNO3 and a molecular weight of 400.27 g/mol. Its IUPAC name is ethyl 4-[(4-bromo-5-phenylpenta-2,4-dienoyl)amino]benzoate.
| Compound Name | ethyl 4-[(4-bromo-5-phenylpenta-2,4-dienoyl)amino]benzoate |
|---|---|
| PubChem CID | 3512602 |
| Molecular Formula | C20H18BrNO3 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | ethyl 4-[(4-bromo-5-phenylpenta-2,4-dienoyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C=CC(Br)=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H18BrNO3/c1-2-25-20(24)16-8-11-18(12-9-16)22-19(23)13-10-17(21)14-15-6-4-3-5-7-15/h3-14H,2H2,1H3,(H,22,23) |
| InChIKey | IDXWUJBIELFPMO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|