C29H22Cl2N2O2S — CID 21168530
(E)-N-[4-[2-(3,4-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-phenylprop-2-enamide (PubChem CID 21168530) has the molecular formula C29H22Cl2N2O2S and a molecular weight of 533.48 g/mol. Its IUPAC name is (E)-N-[4-[2-(3,4-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-[2-(3,4-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 21168530 |
| Molecular Formula | C29H22Cl2N2O2S |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | (E)-N-[4-[2-(3,4-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1ccc(SC(C(=O)Nc2ccc(Cl)c(Cl)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H22Cl2N2O2S/c30-25-17-14-23(19-26(25)31)33-29(35)28(21-9-5-2-6-10-21)36-24-15-12-22(13-16-24)32-27(34)18-11-20-7-3-1-4-8-20/h1-19,28H,(H,32,34)(H,33,35)/b18-11+ |
| InChIKey | YYFXCKPUZSNQJP-WOJGMQOQSA-N |
| XLogP | 8.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|