C25H21ClN2O4S — CID 22786182
(E)-4-[4-[2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 22786182) has the molecular formula C25H21ClN2O4S and a molecular weight of 480.97 g/mol. Its IUPAC name is (E)-4-[4-[2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 22786182 |
| Molecular Formula | C25H21ClN2O4S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | (E)-4-[4-[2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | Cc1ccc(NC(=O)C(Sc2ccc(NC(=O)/C=C/C(=O)O)cc2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C25H21ClN2O4S/c1-16-7-8-19(15-21(16)26)28-25(32)24(17-5-3-2-4-6-17)33-20-11-9-18(10-12-20)27-22(29)13-14-23(30)31/h2-15,24H,1H3,(H,27,29)(H,28,32)(H,30,31)/b14-13+ |
| InChIKey | BOOKGBOVBWYFKT-BUHFOSPRSA-N |
| XLogP | 5.70 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|