C28H22N2O4S — CID 18896944
(E)-4-[3-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 18896944) has the molecular formula C28H22N2O4S and a molecular weight of 482.56 g/mol. Its IUPAC name is (E)-4-[3-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 18896944 |
| Molecular Formula | C28H22N2O4S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | (E)-4-[3-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1cccc(SC(C(=O)Nc2ccc3ccccc3c2)c2ccccc2)c1 |
| InChI | InChI=1S/C28H22N2O4S/c31-25(15-16-26(32)33)29-22-11-6-12-24(18-22)35-27(20-8-2-1-3-9-20)28(34)30-23-14-13-19-7-4-5-10-21(19)17-23/h1-18,27H,(H,29,31)(H,30,34)(H,32,33)/b16-15+ |
| InChIKey | JJVMCAYJHQGCJF-FOCLMDBBSA-N |
| XLogP | 5.89 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|