C24H24F3N3O2S — CID 42735167
N-cyclohexyl-2-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]sulfanylpropanamide (PubChem CID 42735167) has the molecular formula C24H24F3N3O2S and a molecular weight of 475.54 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]sulfanylpropanamide.
| Compound Name | N-cyclohexyl-2-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 42735167 |
| Molecular Formula | C24H24F3N3O2S |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | N-cyclohexyl-2-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nc2ccccc2c(=O)n1-c1cccc(C(F)(F)F)c1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C24H24F3N3O2S/c1-15(21(31)28-17-9-3-2-4-10-17)33-23-29-20-13-6-5-12-19(20)22(32)30(23)18-11-7-8-16(14-18)24(25,26)27/h5-8,11-15,17H,2-4,9-10H2,1H3,(H,28,31) |
| InChIKey | JFIQRESIRQRYHF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |