C18H15F4N3O — CID 90236609
2-(3-aminopropyl)-5-fluoro-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 90236609) has the molecular formula C18H15F4N3O and a molecular weight of 365.33 g/mol. Its IUPAC name is 2-(3-aminopropyl)-5-fluoro-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 2-(3-aminopropyl)-5-fluoro-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 90236609 |
| Molecular Formula | C18H15F4N3O |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-(3-aminopropyl)-5-fluoro-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | NCCCc1nc2cccc(F)c2c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F4N3O/c19-13-6-2-7-14-16(13)17(26)25(15(24-14)8-3-9-23)12-5-1-4-11(10-12)18(20,21)22/h1-2,4-7,10H,3,8-9,23H2 |
| InChIKey | OJHGPROORSCZLC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |