C17H13F3N2O — CID 144835217
3-(2,6-difluorophenyl)-5-fluoro-2-propylquinazolin-4-one (PubChem CID 144835217) has the molecular formula C17H13F3N2O and a molecular weight of 318.30 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-5-fluoro-2-propylquinazolin-4-one.
| Compound Name | 3-(2,6-difluorophenyl)-5-fluoro-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 144835217 |
| Molecular Formula | C17H13F3N2O |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 3-(2,6-difluorophenyl)-5-fluoro-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2cccc(F)c2c(=O)n1-c1c(F)cccc1F |
| InChI | InChI=1S/C17H13F3N2O/c1-2-5-14-21-13-9-4-6-10(18)15(13)17(23)22(14)16-11(19)7-3-8-12(16)20/h3-4,6-9H,2,5H2,1H3 |
| InChIKey | RMLRPBJKIXFBIK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |