C18H16ClFN2O — CID 144835112
3-(3-chloro-4-methylphenyl)-5-fluoro-2-propylquinazolin-4-one (PubChem CID 144835112) has the molecular formula C18H16ClFN2O and a molecular weight of 330.79 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-5-fluoro-2-propylquinazolin-4-one.
| Compound Name | 3-(3-chloro-4-methylphenyl)-5-fluoro-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 144835112 |
| Molecular Formula | C18H16ClFN2O |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-5-fluoro-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2cccc(F)c2c(=O)n1-c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C18H16ClFN2O/c1-3-5-16-21-15-7-4-6-14(20)17(15)18(23)22(16)12-9-8-11(2)13(19)10-12/h4,6-10H,3,5H2,1-2H3 |
| InChIKey | BVXQQBJRKKLICJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |