C17H12F3NO — CID 144835469
2-(3,4-difluorophenyl)-3-ethyl-8-fluoroisoquinolin-1-one (PubChem CID 144835469) has the molecular formula C17H12F3NO and a molecular weight of 303.28 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-3-ethyl-8-fluoroisoquinolin-1-one.
| Compound Name | 2-(3,4-difluorophenyl)-3-ethyl-8-fluoroisoquinolin-1-one |
|---|---|
| PubChem CID | 144835469 |
| Molecular Formula | C17H12F3NO |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-(3,4-difluorophenyl)-3-ethyl-8-fluoroisoquinolin-1-one |
| SMILES | CCc1cc2cccc(F)c2c(=O)n1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H12F3NO/c1-2-11-8-10-4-3-5-14(19)16(10)17(22)21(11)12-6-7-13(18)15(20)9-12/h3-9H,2H2,1H3 |
| InChIKey | FQQWDWPXXQYNOC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |