C18H13ClF3NO2 — CID 122538501
8-chloro-3-ethyl-2-[4-(trifluoromethoxy)phenyl]isoquinolin-1-one (PubChem CID 122538501) has the molecular formula C18H13ClF3NO2 and a molecular weight of 367.75 g/mol. Its IUPAC name is 8-chloro-3-ethyl-2-[4-(trifluoromethoxy)phenyl]isoquinolin-1-one.
| Compound Name | 8-chloro-3-ethyl-2-[4-(trifluoromethoxy)phenyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 122538501 |
| Molecular Formula | C18H13ClF3NO2 |
| Molecular Weight | 367.75 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 8-chloro-3-ethyl-2-[4-(trifluoromethoxy)phenyl]isoquinolin-1-one |
| SMILES | CCc1cc2cccc(Cl)c2c(=O)n1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H13ClF3NO2/c1-2-12-10-11-4-3-5-15(19)16(11)17(24)23(12)13-6-8-14(9-7-13)25-18(20,21)22/h3-10H,2H2,1H3 |
| InChIKey | NZIPDALFAFXCNS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.75 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |