C22H22ClN5O3S — CID 144543957
8-chloro-3-ethyl-2-phenylisoquinolin-1-one;5-methylsulfonylpyrimidine-2,4-diamine (PubChem CID 144543957) has the molecular formula C22H22ClN5O3S and a molecular weight of 471.97 g/mol. Its IUPAC name is 8-chloro-3-ethyl-2-phenylisoquinolin-1-one;5-methylsulfonylpyrimidine-2,4-diamine.
| Compound Name | 8-chloro-3-ethyl-2-phenylisoquinolin-1-one;5-methylsulfonylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 144543957 |
| Molecular Formula | C22H22ClN5O3S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 8-chloro-3-ethyl-2-phenylisoquinolin-1-one;5-methylsulfonylpyrimidine-2,4-diamine |
| SMILES | CCc1cc2cccc(Cl)c2c(=O)n1-c1ccccc1.CS(=O)(=O)c1cnc(N)nc1N |
| InChI | InChI=1S/C17H14ClNO.C5H8N4O2S/c1-2-13-11-12-7-6-10-15(18)16(12)17(20)19(13)14-8-4-3-5-9-14;1-12(10,11)3-2-8-5(7)9-4(3)6/h3-11H,2H2,1H3;2H,1H3,(H4,6,7,8,9) |
| InChIKey | HXKVGAKGLHXVGT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |