C17H12ClF3N2O — CID 118493670
5-chloro-2-propyl-3-(2,4,6-trifluorophenyl)quinazolin-4-one (PubChem CID 118493670) has the molecular formula C17H12ClF3N2O and a molecular weight of 352.74 g/mol. Its IUPAC name is 5-chloro-2-propyl-3-(2,4,6-trifluorophenyl)quinazolin-4-one.
| Compound Name | 5-chloro-2-propyl-3-(2,4,6-trifluorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 118493670 |
| Molecular Formula | C17H12ClF3N2O |
| Molecular Weight | 352.74 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 5-chloro-2-propyl-3-(2,4,6-trifluorophenyl)quinazolin-4-one |
| SMILES | CCCc1nc2cccc(Cl)c2c(=O)n1-c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C17H12ClF3N2O/c1-2-4-14-22-13-6-3-5-10(18)15(13)17(24)23(14)16-11(20)7-9(19)8-12(16)21/h3,5-8H,2,4H2,1H3 |
| InChIKey | BOWLIQYPIMPSTP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.74 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |