C18H16ClN3O4 — CID 90237261
2-[5-chloro-3-(3-methoxyphenyl)-4-oxoquinazolin-2-yl]ethylcarbamic acid (PubChem CID 90237261) has the molecular formula C18H16ClN3O4 and a molecular weight of 373.80 g/mol. Its IUPAC name is 2-[5-chloro-3-(3-methoxyphenyl)-4-oxoquinazolin-2-yl]ethylcarbamic acid.
| Compound Name | 2-[5-chloro-3-(3-methoxyphenyl)-4-oxoquinazolin-2-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 90237261 |
| Molecular Formula | C18H16ClN3O4 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-[5-chloro-3-(3-methoxyphenyl)-4-oxoquinazolin-2-yl]ethylcarbamic acid |
| SMILES | COc1cccc(-n2c(CCNC(=O)O)nc3cccc(Cl)c3c2=O)c1 |
| InChI | InChI=1S/C18H16ClN3O4/c1-26-12-5-2-4-11(10-12)22-15(8-9-20-18(24)25)21-14-7-3-6-13(19)16(14)17(22)23/h2-7,10,20H,8-9H2,1H3,(H,24,25) |
| InChIKey | MPQBKBWPNPLWJH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |