C21H21ClFN3O3 — CID 90236466
tert-butyl N-[2-(5-chloro-8-fluoro-4-oxo-3-phenylquinazolin-2-yl)ethyl]carbamate (PubChem CID 90236466) has the molecular formula C21H21ClFN3O3 and a molecular weight of 417.87 g/mol. Its IUPAC name is tert-butyl N-[2-(5-chloro-8-fluoro-4-oxo-3-phenylquinazolin-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(5-chloro-8-fluoro-4-oxo-3-phenylquinazolin-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 90236466 |
| Molecular Formula | C21H21ClFN3O3 |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | tert-butyl N-[2-(5-chloro-8-fluoro-4-oxo-3-phenylquinazolin-2-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1nc2c(F)ccc(Cl)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C21H21ClFN3O3/c1-21(2,3)29-20(28)24-12-11-16-25-18-15(23)10-9-14(22)17(18)19(27)26(16)13-7-5-4-6-8-13/h4-10H,11-12H2,1-3H3,(H,24,28) |
| InChIKey | XYGUQZXSZZZOFG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |