C15H10ClF2N3O — CID 144759676
5-chloro-2-ethyl-8-fluoro-3-(5-fluoro-3-pyridinyl)quinazolin-4-one (PubChem CID 144759676) has the molecular formula C15H10ClF2N3O and a molecular weight of 321.71 g/mol. Its IUPAC name is 5-chloro-2-ethyl-8-fluoro-3-(5-fluoro-3-pyridinyl)quinazolin-4-one.
| Compound Name | 5-chloro-2-ethyl-8-fluoro-3-(5-fluoro-3-pyridinyl)quinazolin-4-one |
|---|---|
| PubChem CID | 144759676 |
| Molecular Formula | C15H10ClF2N3O |
| Molecular Weight | 321.71 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 5-chloro-2-ethyl-8-fluoro-3-(5-fluoro-3-pyridinyl)quinazolin-4-one |
| SMILES | CCc1nc2c(F)ccc(Cl)c2c(=O)n1-c1cncc(F)c1 |
| InChI | InChI=1S/C15H10ClF2N3O/c1-2-12-20-14-11(18)4-3-10(16)13(14)15(22)21(12)9-5-8(17)6-19-7-9/h3-7H,2H2,1H3 |
| InChIKey | VSIDCSJBMVGVCQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.71 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |