C16H14Cl2N4O — CID 134364837
3-(6-amino-4-methyl-3-pyridinyl)-5,8-dichloro-2-ethylquinazolin-4-one (PubChem CID 134364837) has the molecular formula C16H14Cl2N4O and a molecular weight of 349.22 g/mol. Its IUPAC name is 3-(6-amino-4-methyl-3-pyridinyl)-5,8-dichloro-2-ethylquinazolin-4-one.
| Compound Name | 3-(6-amino-4-methyl-3-pyridinyl)-5,8-dichloro-2-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 134364837 |
| Molecular Formula | C16H14Cl2N4O |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 3-(6-amino-4-methyl-3-pyridinyl)-5,8-dichloro-2-ethylquinazolin-4-one |
| SMILES | CCc1nc2c(Cl)ccc(Cl)c2c(=O)n1-c1cnc(N)cc1C |
| InChI | InChI=1S/C16H14Cl2N4O/c1-3-13-21-15-10(18)5-4-9(17)14(15)16(23)22(13)11-7-20-12(19)6-8(11)2/h4-7H,3H2,1-2H3,(H2,19,20) |
| InChIKey | AHSRUIAZWYVXRL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |