C16H10F4N2O — CID 135244703
3-(3,5-difluorophenyl)-2-ethyl-5,6-difluoroquinazolin-4-one (PubChem CID 135244703) has the molecular formula C16H10F4N2O and a molecular weight of 322.26 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-2-ethyl-5,6-difluoroquinazolin-4-one.
| Compound Name | 3-(3,5-difluorophenyl)-2-ethyl-5,6-difluoroquinazolin-4-one |
|---|---|
| PubChem CID | 135244703 |
| Molecular Formula | C16H10F4N2O |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 3-(3,5-difluorophenyl)-2-ethyl-5,6-difluoroquinazolin-4-one |
| SMILES | CCc1nc2ccc(F)c(F)c2c(=O)n1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H10F4N2O/c1-2-13-21-12-4-3-11(19)15(20)14(12)16(23)22(13)10-6-8(17)5-9(18)7-10/h3-7H,2H2,1H3 |
| InChIKey | TVXYKXCFYCYRJW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |