C15H9ClF2N2O — CID 61064933
2-(chloromethyl)-3-(3,5-difluorophenyl)quinazolin-4-one (PubChem CID 61064933) has the molecular formula C15H9ClF2N2O and a molecular weight of 306.70 g/mol. Its IUPAC name is 2-(chloromethyl)-3-(3,5-difluorophenyl)quinazolin-4-one.
| Compound Name | 2-(chloromethyl)-3-(3,5-difluorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 61064933 |
| Molecular Formula | C15H9ClF2N2O |
| Molecular Weight | 306.70 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 2-(chloromethyl)-3-(3,5-difluorophenyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(CCl)n1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H9ClF2N2O/c16-8-14-19-13-4-2-1-3-12(13)15(21)20(14)11-6-9(17)5-10(18)7-11/h1-7H,8H2 |
| InChIKey | LEJNHNHSMGXHBD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.70 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|