C21H22FN3O — CID 991488
2-(azepan-1-ylmethyl)-3-(4-fluorophenyl)quinazolin-4-one (PubChem CID 991488) has the molecular formula C21H22FN3O and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-(azepan-1-ylmethyl)-3-(4-fluorophenyl)quinazolin-4-one.
| Compound Name | 2-(azepan-1-ylmethyl)-3-(4-fluorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 991488 |
| Molecular Formula | C21H22FN3O |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-(azepan-1-ylmethyl)-3-(4-fluorophenyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(CN2CCCCCC2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H22FN3O/c22-16-9-11-17(12-10-16)25-20(15-24-13-5-1-2-6-14-24)23-19-8-4-3-7-18(19)21(25)26/h3-4,7-12H,1-2,5-6,13-15H2 |
| InChIKey | RYCFWRHDOYAKQC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |