C22H23FN4O2 — CID 110294926
1-cyclohexyl-3-[[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]methyl]urea (PubChem CID 110294926) has the molecular formula C22H23FN4O2 and a molecular weight of 394.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]methyl]urea.
| Compound Name | 1-cyclohexyl-3-[[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 110294926 |
| Molecular Formula | C22H23FN4O2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 1-cyclohexyl-3-[[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]methyl]urea |
| SMILES | O=C(NCc1nc2ccccc2c(=O)n1-c1ccc(F)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C22H23FN4O2/c23-15-10-12-17(13-11-15)27-20(26-19-9-5-4-8-18(19)21(27)28)14-24-22(29)25-16-6-2-1-3-7-16/h4-5,8-13,16H,1-3,6-7,14H2,(H2,24,25,29) |
| InChIKey | XEANJWHOXJQBEC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |