C21H25N3O2 — CID 123773332
tert-butyl N-[2-(4-methyl-1-phenylbenzimidazol-2-yl)ethyl]carbamate (PubChem CID 123773332) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is tert-butyl N-[2-(4-methyl-1-phenylbenzimidazol-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-methyl-1-phenylbenzimidazol-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 123773332 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | tert-butyl N-[2-(4-methyl-1-phenylbenzimidazol-2-yl)ethyl]carbamate |
| SMILES | Cc1cccc2c1nc(CCNC(=O)OC(C)(C)C)n2-c1ccccc1 |
| InChI | InChI=1S/C21H25N3O2/c1-15-9-8-12-17-19(15)23-18(24(17)16-10-6-5-7-11-16)13-14-22-20(25)26-21(2,3)4/h5-12H,13-14H2,1-4H3,(H,22,25) |
| InChIKey | KNKCFHCYFZJHBG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |