C21H23FN2O2 — CID 123463276
tert-butyl N-[2-[1-(3-fluorophenyl)indol-2-yl]ethyl]carbamate (PubChem CID 123463276) has the molecular formula C21H23FN2O2 and a molecular weight of 354.43 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(3-fluorophenyl)indol-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(3-fluorophenyl)indol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 123463276 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | tert-butyl N-[2-[1-(3-fluorophenyl)indol-2-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1cc2ccccc2n1-c1cccc(F)c1 |
| InChI | InChI=1S/C21H23FN2O2/c1-21(2,3)26-20(25)23-12-11-18-13-15-7-4-5-10-19(15)24(18)17-9-6-8-16(22)14-17/h4-10,13-14H,11-12H2,1-3H3,(H,23,25) |
| InChIKey | IXVGVOANFLALQD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |