C16H19F2N3O2 — CID 104952037
tert-butyl N-[2-[3-(3,5-difluorophenyl)imidazol-4-yl]ethyl]carbamate (PubChem CID 104952037) has the molecular formula C16H19F2N3O2 and a molecular weight of 323.34 g/mol. Its IUPAC name is tert-butyl N-[2-[3-(3,5-difluorophenyl)imidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-(3,5-difluorophenyl)imidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 104952037 |
| Molecular Formula | C16H19F2N3O2 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | tert-butyl N-[2-[3-(3,5-difluorophenyl)imidazol-4-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1cncn1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H19F2N3O2/c1-16(2,3)23-15(22)20-5-4-13-9-19-10-21(13)14-7-11(17)6-12(18)8-14/h6-10H,4-5H2,1-3H3,(H,20,22) |
| InChIKey | RORBYEVVAUVILA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |