C16H22N4O3 — CID 104952013
tert-butyl N-[2-[3-(6-methoxy-3-pyridinyl)imidazol-4-yl]ethyl]carbamate (PubChem CID 104952013) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is tert-butyl N-[2-[3-(6-methoxy-3-pyridinyl)imidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-(6-methoxy-3-pyridinyl)imidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 104952013 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | tert-butyl N-[2-[3-(6-methoxy-3-pyridinyl)imidazol-4-yl]ethyl]carbamate |
| SMILES | COc1ccc(-n2cncc2CCNC(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C16H22N4O3/c1-16(2,3)23-15(21)18-8-7-13-9-17-11-20(13)12-5-6-14(22-4)19-10-12/h5-6,9-11H,7-8H2,1-4H3,(H,18,21) |
| InChIKey | MBRBOSARMUGQNP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |