C17H24N4O2 — CID 104952089
tert-butyl N-[2-[3-(1-pyridin-2-ylethyl)imidazol-4-yl]ethyl]carbamate (PubChem CID 104952089) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is tert-butyl N-[2-[3-(1-pyridin-2-ylethyl)imidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-(1-pyridin-2-ylethyl)imidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 104952089 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | tert-butyl N-[2-[3-(1-pyridin-2-ylethyl)imidazol-4-yl]ethyl]carbamate |
| SMILES | CC(c1ccccn1)n1cncc1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24N4O2/c1-13(15-7-5-6-9-19-15)21-12-18-11-14(21)8-10-20-16(22)23-17(2,3)4/h5-7,9,11-13H,8,10H2,1-4H3,(H,20,22) |
| InChIKey | RMKDPZIWEXXZAE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |