C19H26FN3O2 — CID 112754022
tert-butyl N-[1-[3-(3-fluoro-4-methylphenyl)imidazol-4-yl]-2-methylpropan-2-yl]carbamate (PubChem CID 112754022) has the molecular formula C19H26FN3O2 and a molecular weight of 347.43 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(3-fluoro-4-methylphenyl)imidazol-4-yl]-2-methylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(3-fluoro-4-methylphenyl)imidazol-4-yl]-2-methylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 112754022 |
| Molecular Formula | C19H26FN3O2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | tert-butyl N-[1-[3-(3-fluoro-4-methylphenyl)imidazol-4-yl]-2-methylpropan-2-yl]carbamate |
| SMILES | Cc1ccc(-n2cncc2CC(C)(C)NC(=O)OC(C)(C)C)cc1F |
| InChI | InChI=1S/C19H26FN3O2/c1-13-7-8-14(9-16(13)20)23-12-21-11-15(23)10-19(5,6)22-17(24)25-18(2,3)4/h7-9,11-12H,10H2,1-6H3,(H,22,24) |
| InChIKey | PCCAHFAQGIMZRW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |