C18H31N3O3 — CID 112754089
tert-butyl N-[1-[3-(4-hydroxycyclohexyl)imidazol-4-yl]-2-methylpropan-2-yl]carbamate (PubChem CID 112754089) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(4-hydroxycyclohexyl)imidazol-4-yl]-2-methylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(4-hydroxycyclohexyl)imidazol-4-yl]-2-methylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 112754089 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | tert-butyl N-[1-[3-(4-hydroxycyclohexyl)imidazol-4-yl]-2-methylpropan-2-yl]carbamate |
| SMILES | CC(C)(Cc1cncn1C1CCC(O)CC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31N3O3/c1-17(2,3)24-16(23)20-18(4,5)10-14-11-19-12-21(14)13-6-8-15(22)9-7-13/h11-13,15,22H,6-10H2,1-5H3,(H,20,23) |
| InChIKey | XAJCTPCCSLOAME-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |