C20H29N3O2 — CID 112754038
tert-butyl N-[2-methyl-1-[3-[(2-methylphenyl)methyl]imidazol-4-yl]propan-2-yl]carbamate (PubChem CID 112754038) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-1-[3-[(2-methylphenyl)methyl]imidazol-4-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-1-[3-[(2-methylphenyl)methyl]imidazol-4-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 112754038 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | tert-butyl N-[2-methyl-1-[3-[(2-methylphenyl)methyl]imidazol-4-yl]propan-2-yl]carbamate |
| SMILES | Cc1ccccc1Cn1cncc1CC(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29N3O2/c1-15-9-7-8-10-16(15)13-23-14-21-12-17(23)11-20(5,6)22-18(24)25-19(2,3)4/h7-10,12,14H,11,13H2,1-6H3,(H,22,24) |
| InChIKey | WQYJRJFVNCPORT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |