C22H19FN7O+ — CID 123942939
2-[3-(6-amino-7H-purin-1-ium-1-yl)propyl]-5-fluoro-3-phenylquinazolin-4-one (PubChem CID 123942939) has the molecular formula C22H19FN7O+ and a molecular weight of 416.44 g/mol. Its IUPAC name is 2-[3-(6-amino-7H-purin-1-ium-1-yl)propyl]-5-fluoro-3-phenylquinazolin-4-one.
| Compound Name | 2-[3-(6-amino-7H-purin-1-ium-1-yl)propyl]-5-fluoro-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 123942939 |
| Molecular Formula | C22H19FN7O+ |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2-[3-(6-amino-7H-purin-1-ium-1-yl)propyl]-5-fluoro-3-phenylquinazolin-4-one |
| SMILES | Nc1c2[nH]cnc2nc[n+]1CCCc1nc2cccc(F)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C22H18FN7O/c23-15-8-4-9-16-18(15)22(31)30(14-6-2-1-3-7-14)17(28-16)10-5-11-29-13-27-21-19(20(29)24)25-12-26-21/h1-4,6-9,12-13H,5,10-11H2,(H2,24,25,26)/p+1 |
| InChIKey | RIMKAWAHHVGKHP-UHFFFAOYSA-O |
| XLogP | 2.30 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|