C28H22F2N4O4 — CID 56960305
5-[3-(4-fluorophenyl)-7-[5-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-3-yl]-4-oxoquinazolin-2-yl]pentanoic acid (PubChem CID 56960305) has the molecular formula C28H22F2N4O4 and a molecular weight of 516.50 g/mol. Its IUPAC name is 5-[3-(4-fluorophenyl)-7-[5-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-3-yl]-4-oxoquinazolin-2-yl]pentanoic acid.
| Compound Name | 5-[3-(4-fluorophenyl)-7-[5-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-3-yl]-4-oxoquinazolin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 56960305 |
| Molecular Formula | C28H22F2N4O4 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 5-[3-(4-fluorophenyl)-7-[5-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-3-yl]-4-oxoquinazolin-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1nc2cc(-c3noc(Cc4ccc(F)cc4)n3)ccc2c(=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H22F2N4O4/c29-19-8-5-17(6-9-19)15-25-32-27(33-38-25)18-7-14-22-23(16-18)31-24(3-1-2-4-26(35)36)34(28(22)37)21-12-10-20(30)11-13-21/h5-14,16H,1-4,15H2,(H,35,36) |
| InChIKey | RVZYFYKOVAGAHP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|