C30H26FN3O4 — CID 123302157
5-[7-(6-benzyl-2H-1,3-oxazin-4-yl)-3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]pentanoic acid (PubChem CID 123302157) has the molecular formula C30H26FN3O4 and a molecular weight of 511.55 g/mol. Its IUPAC name is 5-[7-(6-benzyl-2H-1,3-oxazin-4-yl)-3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]pentanoic acid.
| Compound Name | 5-[7-(6-benzyl-2H-1,3-oxazin-4-yl)-3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 123302157 |
| Molecular Formula | C30H26FN3O4 |
| Molecular Weight | 511.55 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 5-[7-(6-benzyl-2H-1,3-oxazin-4-yl)-3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1nc2cc(C3=NCOC(Cc4ccccc4)=C3)ccc2c(=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C30H26FN3O4/c31-22-11-13-23(14-12-22)34-28(8-4-5-9-29(35)36)33-27-17-21(10-15-25(27)30(34)37)26-18-24(38-19-32-26)16-20-6-2-1-3-7-20/h1-3,6-7,10-15,17-18H,4-5,8-9,16,19H2,(H,35,36) |
| InChIKey | GXEHICWVBYETDT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|