C29H26N4O4 — CID 134476355
5-[7-(5-benzyl-4,5-dihydro-1,2-oxazol-3-yl)-4-oxo-3-phenylquinazolin-2-yl]-N-oxopentanamide (PubChem CID 134476355) has the molecular formula C29H26N4O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is 5-[7-(5-benzyl-4,5-dihydro-1,2-oxazol-3-yl)-4-oxo-3-phenylquinazolin-2-yl]-N-oxopentanamide.
| Compound Name | 5-[7-(5-benzyl-4,5-dihydro-1,2-oxazol-3-yl)-4-oxo-3-phenylquinazolin-2-yl]-N-oxopentanamide |
|---|---|
| PubChem CID | 134476355 |
| Molecular Formula | C29H26N4O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 5-[7-(5-benzyl-4,5-dihydro-1,2-oxazol-3-yl)-4-oxo-3-phenylquinazolin-2-yl]-N-oxopentanamide |
| SMILES | O=NC(=O)CCCCc1nc2cc(C3=NOC(Cc4ccccc4)C3)ccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C29H26N4O4/c34-28(31-36)14-8-7-13-27-30-26-18-21(25-19-23(37-32-25)17-20-9-3-1-4-10-20)15-16-24(26)29(35)33(27)22-11-5-2-6-12-22/h1-6,9-12,15-16,18,23H,7-8,13-14,17,19H2 |
| InChIKey | VVYAPYMFAAZKPI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 102.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|