C29H28IN3O4 — CID 134476788
2-(5,5-dihydroxypentyl)-3-(4-iodophenyl)-7-[(4R,5S)-4-methyl-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]quinazolin-4-one (PubChem CID 134476788) has the molecular formula C29H28IN3O4 and a molecular weight of 609.46 g/mol. Its IUPAC name is 2-(5,5-dihydroxypentyl)-3-(4-iodophenyl)-7-[(4R,5S)-4-methyl-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]quinazolin-4-one.
| Compound Name | 2-(5,5-dihydroxypentyl)-3-(4-iodophenyl)-7-[(4R,5S)-4-methyl-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 134476788 |
| Molecular Formula | C29H28IN3O4 |
| Molecular Weight | 609.46 g/mol |
| Exact Mass | 609.11 |
| IUPAC Name | 2-(5,5-dihydroxypentyl)-3-(4-iodophenyl)-7-[(4R,5S)-4-methyl-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]quinazolin-4-one |
| SMILES | C[C@@H]1C(c2ccc3c(=O)n(-c4ccc(I)cc4)c(CCCCC(O)O)nc3c2)=NO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C29H28IN3O4/c1-18-27(32-37-28(18)19-7-3-2-4-8-19)20-11-16-23-24(17-20)31-25(9-5-6-10-26(34)35)33(29(23)36)22-14-12-21(30)13-15-22/h2-4,7-8,11-18,26,28,34-35H,5-6,9-10H2,1H3/t18-,28+/m1/s1 |
| InChIKey | ASCDOWYYZOXUBP-WRHNGFHOSA-N |
| XLogP | 5.13 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|